C12H13FN2 — CID 115591788
3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]propanenitrile (PubChem CID 115591788) has the molecular formula C12H13FN2 and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]propanenitrile.
| Compound Name | 3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]propanenitrile |
|---|---|
| PubChem CID | 115591788 |
| Molecular Formula | C12H13FN2 |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.11 |
| IUPAC Name | 3-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]propanenitrile |
| SMILES | N#CCCNC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H13FN2/c13-10-3-4-11-9(8-10)2-5-12(11)15-7-1-6-14/h3-4,8,12,15H,1-2,5,7H2 |
| InChIKey | FBTRQVZDNGQZCH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|