C14H20FNO — CID 107303158
5-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentan-1-ol (PubChem CID 107303158) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is 5-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentan-1-ol.
| Compound Name | 5-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107303158 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 5-[(5-fluoro-2,3-dihydro-1H-inden-1-yl)amino]pentan-1-ol |
| SMILES | OCCCCCNC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C14H20FNO/c15-12-5-6-13-11(10-12)4-7-14(13)16-8-2-1-3-9-17/h5-6,10,14,16-17H,1-4,7-9H2 |
| InChIKey | INHWQEPVFDHYBN-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|