C14H21NO — CID 106840528
4-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol (PubChem CID 106840528) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 4-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol.
| Compound Name | 4-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol |
|---|---|
| PubChem CID | 106840528 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 4-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]butan-1-ol |
| SMILES | Cc1ccc2c(c1)C(NCCCCO)CC2 |
| InChI | InChI=1S/C14H21NO/c1-11-4-5-12-6-7-14(13(12)10-11)15-8-2-3-9-16/h4-5,10,14-16H,2-3,6-9H2,1H3 |
| InChIKey | WJUZBXNUCKMTEP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|