C15H22N2O — CID 114161832
5-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]pentanamide (PubChem CID 114161832) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 5-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]pentanamide.
| Compound Name | 5-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114161832 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 5-[(6-methyl-2,3-dihydro-1H-inden-1-yl)amino]pentanamide |
| SMILES | Cc1ccc2c(c1)C(NCCCCC(N)=O)CC2 |
| InChI | InChI=1S/C15H22N2O/c1-11-5-6-12-7-8-14(13(12)10-11)17-9-3-2-4-15(16)18/h5-6,10,14,17H,2-4,7-9H2,1H3,(H2,16,18) |
| InChIKey | YMMVSEDHBGYSSZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|