C12H16FNS — CID 115706133
5-fluoro-N-(2-methylsulfanylethyl)-2,3-dihydro-1H-inden-1-amine (PubChem CID 115706133) has the molecular formula C12H16FNS and a molecular weight of 225.33 g/mol. Its IUPAC name is 5-fluoro-N-(2-methylsulfanylethyl)-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 5-fluoro-N-(2-methylsulfanylethyl)-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 115706133 |
| Molecular Formula | C12H16FNS |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 5-fluoro-N-(2-methylsulfanylethyl)-2,3-dihydro-1H-inden-1-amine |
| SMILES | CSCCNC1CCc2cc(F)ccc21 |
| InChI | InChI=1S/C12H16FNS/c1-15-7-6-14-12-5-2-9-8-10(13)3-4-11(9)12/h3-4,8,12,14H,2,5-7H2,1H3 |
| InChIKey | YQKOQVOVFRJLGK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|