C17H13F2NO3 — CID 167790119
(5-fluoro-2,3-dihydro-1H-inden-1-yl) 5-carbamoyl-2-fluorobenzoate (PubChem CID 167790119) has the molecular formula C17H13F2NO3 and a molecular weight of 317.29 g/mol. Its IUPAC name is (5-fluoro-2,3-dihydro-1H-inden-1-yl) 5-carbamoyl-2-fluorobenzoate.
| Compound Name | (5-fluoro-2,3-dihydro-1H-inden-1-yl) 5-carbamoyl-2-fluorobenzoate |
|---|---|
| PubChem CID | 167790119 |
| Molecular Formula | C17H13F2NO3 |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | (5-fluoro-2,3-dihydro-1H-inden-1-yl) 5-carbamoyl-2-fluorobenzoate |
| SMILES | NC(=O)c1ccc(F)c(C(=O)OC2CCc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C17H13F2NO3/c18-11-3-4-12-9(7-11)2-6-15(12)23-17(22)13-8-10(16(20)21)1-5-14(13)19/h1,3-5,7-8,15H,2,6H2,(H2,20,21) |
| InChIKey | VLTPFFZNZJFSPV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |