C17H16FNO2 — CID 81498717
1,2,3,4-tetrahydronaphthalen-1-yl 2-amino-3-fluorobenzoate (PubChem CID 81498717) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is 1,2,3,4-tetrahydronaphthalen-1-yl 2-amino-3-fluorobenzoate.
| Compound Name | 1,2,3,4-tetrahydronaphthalen-1-yl 2-amino-3-fluorobenzoate |
|---|---|
| PubChem CID | 81498717 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 1,2,3,4-tetrahydronaphthalen-1-yl 2-amino-3-fluorobenzoate |
| SMILES | Nc1c(F)cccc1C(=O)OC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H16FNO2/c18-14-9-4-8-13(16(14)19)17(20)21-15-10-3-6-11-5-1-2-7-12(11)15/h1-2,4-5,7-9,15H,3,6,10,19H2 |
| InChIKey | GNNPDHVHBCUFSX-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|