C17H15F2NO2 — CID 175568706
[6-(2,3-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate (PubChem CID 175568706) has the molecular formula C17H15F2NO2 and a molecular weight of 303.31 g/mol. Its IUPAC name is [6-(2,3-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate.
| Compound Name | [6-(2,3-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
|---|---|
| PubChem CID | 175568706 |
| Molecular Formula | C17H15F2NO2 |
| Molecular Weight | 303.31 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | [6-(2,3-difluorophenyl)-1,2,3,4-tetrahydronaphthalen-1-yl] carbamate |
| SMILES | NC(=O)OC1CCCc2cc(-c3cccc(F)c3F)ccc21 |
| InChI | InChI=1S/C17H15F2NO2/c18-14-5-2-4-13(16(14)19)11-7-8-12-10(9-11)3-1-6-15(12)22-17(20)21/h2,4-5,7-9,15H,1,3,6H2,(H2,20,21) |
| InChIKey | YJPKXTQQSHOAAM-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |