C16H13Cl2NO2 — CID 175296823
[6-(2,5-dichlorophenyl)-2,3-dihydro-1H-inden-1-yl] carbamate (PubChem CID 175296823) has the molecular formula C16H13Cl2NO2 and a molecular weight of 322.19 g/mol. Its IUPAC name is [6-(2,5-dichlorophenyl)-2,3-dihydro-1H-inden-1-yl] carbamate.
| Compound Name | [6-(2,5-dichlorophenyl)-2,3-dihydro-1H-inden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296823 |
| Molecular Formula | C16H13Cl2NO2 |
| Molecular Weight | 322.19 g/mol |
| Exact Mass | 321.03 |
| IUPAC Name | [6-(2,5-dichlorophenyl)-2,3-dihydro-1H-inden-1-yl] carbamate |
| SMILES | NC(=O)OC1CCc2ccc(-c3cc(Cl)ccc3Cl)cc21 |
| InChI | InChI=1S/C16H13Cl2NO2/c17-11-4-5-14(18)12(8-11)10-2-1-9-3-6-15(13(9)7-10)21-16(19)20/h1-2,4-5,7-8,15H,3,6H2,(H2,19,20) |
| InChIKey | PWNXAXUVBWHDEV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.19 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |