C17H16ClNO4 — CID 175253937
[7-(4-chloro-3-methoxyphenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate (PubChem CID 175253937) has the molecular formula C17H16ClNO4 and a molecular weight of 333.77 g/mol. Its IUPAC name is [7-(4-chloro-3-methoxyphenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate.
| Compound Name | [7-(4-chloro-3-methoxyphenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175253937 |
| Molecular Formula | C17H16ClNO4 |
| Molecular Weight | 333.77 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | [7-(4-chloro-3-methoxyphenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
| SMILES | COc1cc(-c2ccc3c(c2)OCCC3OC(N)=O)ccc1Cl |
| InChI | InChI=1S/C17H16ClNO4/c1-21-16-9-11(3-5-13(16)18)10-2-4-12-14(23-17(19)20)6-7-22-15(12)8-10/h2-5,8-9,14H,6-7H2,1H3,(H2,19,20) |
| InChIKey | KSMUSRNPRRQHJE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |