C16H14FNO3 — CID 175253063
[7-(3-fluorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate (PubChem CID 175253063) has the molecular formula C16H14FNO3 and a molecular weight of 287.29 g/mol. Its IUPAC name is [7-(3-fluorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate.
| Compound Name | [7-(3-fluorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175253063 |
| Molecular Formula | C16H14FNO3 |
| Molecular Weight | 287.29 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | [7-(3-fluorophenyl)-3,4-dihydro-2H-chromen-4-yl] carbamate |
| SMILES | NC(=O)OC1CCOc2cc(-c3cccc(F)c3)ccc21 |
| InChI | InChI=1S/C16H14FNO3/c17-12-3-1-2-10(8-12)11-4-5-13-14(21-16(18)19)6-7-20-15(13)9-11/h1-5,8-9,14H,6-7H2,(H2,18,19) |
| InChIKey | WTIPLFHNBKWVDH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.29 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |