C24H23NO3 — CID 175254067
[3,3-dimethyl-7-(3-phenylphenyl)-2,4-dihydrochromen-4-yl] carbamate (PubChem CID 175254067) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is [3,3-dimethyl-7-(3-phenylphenyl)-2,4-dihydrochromen-4-yl] carbamate.
| Compound Name | [3,3-dimethyl-7-(3-phenylphenyl)-2,4-dihydrochromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175254067 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | [3,3-dimethyl-7-(3-phenylphenyl)-2,4-dihydrochromen-4-yl] carbamate |
| SMILES | CC1(C)COc2cc(-c3cccc(-c4ccccc4)c3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C24H23NO3/c1-24(2)15-27-21-14-19(11-12-20(21)22(24)28-23(25)26)18-10-6-9-17(13-18)16-7-4-3-5-8-16/h3-14,22H,15H2,1-2H3,(H2,25,26) |
| InChIKey | QFYUADSBUQXZMJ-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |