About (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate
(3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate (PubChem CID 175253181) has the molecular formula C22H21NO3
and a molecular weight of 347.41 g/mol. Its IUPAC name is (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate.
Molecular Properties
| Compound Name | (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate |
| PubChem CID | 175253181 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate |
| SMILES | CC1(C)COc2cc(-c3ccc4ccccc4c3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C22H21NO3/c1-22(2)13-25-19-12-17(9-10-18(19)20(22)26-21(23)24)16-8-7-14-5-3-4-6-15(14)11-16/h3-12,20H,13H2,1-2H3,(H2,23,24) |
| InChIKey | KACIYOXGGRNWEA-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate?
The IUPAC name of (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate (CID 175253181) is (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate.
What is the SMILES notation for (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate?
The canonical SMILES for (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate is CC1(C)COc2cc(-c3ccc4ccccc4c3)ccc2C1OC(N)=O.
What is the InChIKey of (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate?
The InChIKey is KACIYOXGGRNWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21NO3/c1-22(2)13-25-19-12-17(9-10-18(19)20(22)26-21(23)24)16-8-7-14-5-3-4-6-15(14)11-16/h3-12,20H,13H2,1-2H3,(H2,23,24).
What are the key properties of (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate?
(3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate has a molecular weight of 347.41 g/mol, XLogP of 5.06, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,3-dimethyl-7-naphthalen-2-yl-2,4-dihydrochromen-4-yl) carbamate is sourced from PubChem (CID 175253181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).