C20H20FNO3 — CID 175253151
[7-[(E)-2-(3-fluorophenyl)ethenyl]-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate (PubChem CID 175253151) has the molecular formula C20H20FNO3 and a molecular weight of 341.38 g/mol. Its IUPAC name is [7-[(E)-2-(3-fluorophenyl)ethenyl]-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate.
| Compound Name | [7-[(E)-2-(3-fluorophenyl)ethenyl]-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175253151 |
| Molecular Formula | C20H20FNO3 |
| Molecular Weight | 341.38 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | [7-[(E)-2-(3-fluorophenyl)ethenyl]-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
| SMILES | CC1(C)COc2cc(/C=C/c3cccc(F)c3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C20H20FNO3/c1-20(2)12-24-17-11-14(7-6-13-4-3-5-15(21)10-13)8-9-16(17)18(20)25-19(22)23/h3-11,18H,12H2,1-2H3,(H2,22,23)/b7-6+ |
| InChIKey | XOZSUJLWOJEKDJ-VOTSOKGWSA-N |
| XLogP | 4.55 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.38 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|