C20H23NO4 — CID 175252942
[7-(4-ethoxyphenyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate (PubChem CID 175252942) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [7-(4-ethoxyphenyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate.
| Compound Name | [7-(4-ethoxyphenyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
|---|---|
| PubChem CID | 175252942 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [7-(4-ethoxyphenyl)-3,3-dimethyl-2,4-dihydrochromen-4-yl] carbamate |
| SMILES | CCOc1ccc(-c2ccc3c(c2)OCC(C)(C)C3OC(N)=O)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-4-23-15-8-5-13(6-9-15)14-7-10-16-17(11-14)24-12-20(2,3)18(16)25-19(21)22/h5-11,18H,4,12H2,1-3H3,(H2,21,22) |
| InChIKey | GSDTZYSKFYLNNM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |