C22H27NO3 — CID 175296580
[5-(4-butoxyphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296580) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is [5-(4-butoxyphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [5-(4-butoxyphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296580 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | [5-(4-butoxyphenyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CCCCOc1ccc(-c2ccc3c(c2)CC(C)(C)C3OC(N)=O)cc1 |
| InChI | InChI=1S/C22H27NO3/c1-4-5-12-25-18-9-6-15(7-10-18)16-8-11-19-17(13-16)14-22(2,3)20(19)26-21(23)24/h6-11,13,20H,4-5,12,14H2,1-3H3,(H2,23,24) |
| InChIKey | BLPAPKFJPOQEKM-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|