C21H20N2O2 — CID 175296735
(2,2-dimethyl-5-quinolin-3-yl-1,3-dihydroinden-1-yl) carbamate (PubChem CID 175296735) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2,2-dimethyl-5-quinolin-3-yl-1,3-dihydroinden-1-yl) carbamate.
| Compound Name | (2,2-dimethyl-5-quinolin-3-yl-1,3-dihydroinden-1-yl) carbamate |
|---|---|
| PubChem CID | 175296735 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2,2-dimethyl-5-quinolin-3-yl-1,3-dihydroinden-1-yl) carbamate |
| SMILES | CC1(C)Cc2cc(-c3cnc4ccccc4c3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C21H20N2O2/c1-21(2)11-15-9-13(7-8-17(15)19(21)25-20(22)24)16-10-14-5-3-4-6-18(14)23-12-16/h3-10,12,19H,11H2,1-2H3,(H2,22,24) |
| InChIKey | RNCSCLBAMRSPIX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |