C22H26FNO3 — CID 175498078
[(1R)-5-(3-butoxyphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175498078) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is [(1R)-5-(3-butoxyphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [(1R)-5-(3-butoxyphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175498078 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | [(1R)-5-(3-butoxyphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CCCCOc1cccc(-c2cc3c(cc2F)[C@H](OC(N)=O)C(C)(C)C3)c1 |
| InChI | InChI=1S/C22H26FNO3/c1-4-5-9-26-16-8-6-7-14(10-16)17-11-15-13-22(2,3)20(27-21(24)25)18(15)12-19(17)23/h6-8,10-12,20H,4-5,9,13H2,1-3H3,(H2,24,25)/t20-/m0/s1 |
| InChIKey | QUKUIDPUZIKCNI-FQEVSTJZSA-N |
| XLogP | 5.39 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|