C24H30FNO3 — CID 175296671
[5-(4-butoxy-3,5-dimethylphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296671) has the molecular formula C24H30FNO3 and a molecular weight of 399.51 g/mol. Its IUPAC name is [5-(4-butoxy-3,5-dimethylphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [5-(4-butoxy-3,5-dimethylphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296671 |
| Molecular Formula | C24H30FNO3 |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | [5-(4-butoxy-3,5-dimethylphenyl)-6-fluoro-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CCCCOc1c(C)cc(-c2cc3c(cc2F)C(OC(N)=O)C(C)(C)C3)cc1C |
| InChI | InChI=1S/C24H30FNO3/c1-6-7-8-28-21-14(2)9-16(10-15(21)3)18-11-17-13-24(4,5)22(29-23(26)27)19(17)12-20(18)25/h9-12,22H,6-8,13H2,1-5H3,(H2,26,27) |
| InChIKey | PPRQRFLYKDUXJN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|