C20H23NO4 — CID 175296893
[5-[2-(methoxymethoxy)phenyl]-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296893) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is [5-[2-(methoxymethoxy)phenyl]-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [5-[2-(methoxymethoxy)phenyl]-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296893 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [5-[2-(methoxymethoxy)phenyl]-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | COCOc1ccccc1-c1ccc2c(c1)CC(C)(C)C2OC(N)=O |
| InChI | InChI=1S/C20H23NO4/c1-20(2)11-14-10-13(8-9-16(14)18(20)25-19(21)22)15-6-4-5-7-17(15)24-12-23-3/h4-10,18H,11-12H2,1-3H3,(H2,21,22) |
| InChIKey | VLLZDYIMYKNWLN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|