C17H16Cl2N2O2 — CID 175296930
[5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate (PubChem CID 175296930) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is [5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate.
| Compound Name | [5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296930 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | [5-(2,5-dichloro-4-pyridinyl)-2,2-dimethyl-1,3-dihydroinden-1-yl] carbamate |
| SMILES | CC1(C)Cc2cc(-c3cc(Cl)ncc3Cl)ccc2C1OC(N)=O |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-17(2)7-10-5-9(12-6-14(19)21-8-13(12)18)3-4-11(10)15(17)23-16(20)22/h3-6,8,15H,7H2,1-2H3,(H2,20,22) |
| InChIKey | OQRFAEALDLQMPQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|