C17H18N2O3 — CID 175253943
(3,3-dimethyl-7-pyridin-3-yl-2,4-dihydrochromen-4-yl) carbamate (PubChem CID 175253943) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (3,3-dimethyl-7-pyridin-3-yl-2,4-dihydrochromen-4-yl) carbamate.
| Compound Name | (3,3-dimethyl-7-pyridin-3-yl-2,4-dihydrochromen-4-yl) carbamate |
|---|---|
| PubChem CID | 175253943 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | (3,3-dimethyl-7-pyridin-3-yl-2,4-dihydrochromen-4-yl) carbamate |
| SMILES | CC1(C)COc2cc(-c3cccnc3)ccc2C1OC(N)=O |
| InChI | InChI=1S/C17H18N2O3/c1-17(2)10-21-14-8-11(12-4-3-7-19-9-12)5-6-13(14)15(17)22-16(18)20/h3-9,15H,10H2,1-2H3,(H2,18,20) |
| InChIKey | RSJQUCCPERHOKJ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 74.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |