C19H18O4 — CID 170048859
3,4-dihydro-2H-chromen-4-yl 5-ethenyl-2-methoxybenzoate (PubChem CID 170048859) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-4-yl 5-ethenyl-2-methoxybenzoate.
| Compound Name | 3,4-dihydro-2H-chromen-4-yl 5-ethenyl-2-methoxybenzoate |
|---|---|
| PubChem CID | 170048859 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3,4-dihydro-2H-chromen-4-yl 5-ethenyl-2-methoxybenzoate |
| SMILES | C=Cc1ccc(OC)c(C(=O)OC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C19H18O4/c1-3-13-8-9-16(21-2)15(12-13)19(20)23-18-10-11-22-17-7-5-4-6-14(17)18/h3-9,12,18H,1,10-11H2,2H3 |
| InChIKey | XZDGYRSOBOJMFJ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |