3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate

C14H12O4 — CID 119045683

IUPAC3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate
SMILESO=C(OC1CCOc2ccccc21)c1ccoc1
InChIInChI=1S/C14H12O4/c15-14(10-5-7-16-9-10)18-13-6-8-17-12-4-2-1-3-11(12)13/h1-5,7,9,13H,6,8H2
InChIKeyOFXQNCWLVSKZRF-UHFFFAOYSA-N
MW244.25 g/mol
LogP2.96
Rot. Bonds2

About 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate

3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate (PubChem CID 119045683) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate.

Molecular Properties

Compound Name3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate
PubChem CID119045683
Molecular FormulaC14H12O4
Molecular Weight244.25 g/mol
Exact Mass244.07
IUPAC Name3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate
SMILESO=C(OC1CCOc2ccccc21)c1ccoc1
InChIInChI=1S/C14H12O4/c15-14(10-5-7-16-9-10)18-13-6-8-17-12-4-2-1-3-11(12)13/h1-5,7,9,13H,6,8H2
InChIKeyOFXQNCWLVSKZRF-UHFFFAOYSA-N
XLogP2.96
TPSA48.67 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.25
LogP ≤ 52.96
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate?
The IUPAC name of 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate (CID 119045683) is 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate.
What is the SMILES notation for 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate?
The canonical SMILES for 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate is O=C(OC1CCOc2ccccc21)c1ccoc1.
What is the InChIKey of 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate?
The InChIKey is OFXQNCWLVSKZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4/c15-14(10-5-7-16-9-10)18-13-6-8-17-12-4-2-1-3-11(12)13/h1-5,7,9,13H,6,8H2.
What are the key properties of 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate?
3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate has a molecular weight of 244.25 g/mol, XLogP of 2.96, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydro-2H-chromen-4-yl furan-3-carboxylate is sourced from PubChem (CID 119045683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).