About (3-methylcyclobutyl) furan-3-carboxylate
(3-methylcyclobutyl) furan-3-carboxylate (PubChem CID 130683637) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is (3-methylcyclobutyl) furan-3-carboxylate.
Molecular Properties
| Compound Name | (3-methylcyclobutyl) furan-3-carboxylate |
| PubChem CID | 130683637 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (3-methylcyclobutyl) furan-3-carboxylate |
| SMILES | CC1CC(OC(=O)c2ccoc2)C1 |
| InChI | InChI=1S/C10H12O3/c1-7-4-9(5-7)13-10(11)8-2-3-12-6-8/h2-3,6-7,9H,4-5H2,1H3 |
| InChIKey | XZWNYHWKSRNQOZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methylcyclobutyl) furan-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methylcyclobutyl) furan-3-carboxylate?
The IUPAC name of (3-methylcyclobutyl) furan-3-carboxylate (CID 130683637) is (3-methylcyclobutyl) furan-3-carboxylate.
What is the SMILES notation for (3-methylcyclobutyl) furan-3-carboxylate?
The canonical SMILES for (3-methylcyclobutyl) furan-3-carboxylate is CC1CC(OC(=O)c2ccoc2)C1.
What is the InChIKey of (3-methylcyclobutyl) furan-3-carboxylate?
The InChIKey is XZWNYHWKSRNQOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-4-9(5-7)13-10(11)8-2-3-12-6-8/h2-3,6-7,9H,4-5H2,1H3.
What are the key properties of (3-methylcyclobutyl) furan-3-carboxylate?
(3-methylcyclobutyl) furan-3-carboxylate has a molecular weight of 180.20 g/mol, XLogP of 2.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methylcyclobutyl) furan-3-carboxylate is sourced from PubChem (CID 130683637), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).