C17H18O3 — CID 139064912
[(1R,2S)-2-phenylcyclohexyl] furan-3-carboxylate (PubChem CID 139064912) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] furan-3-carboxylate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] furan-3-carboxylate |
|---|---|
| PubChem CID | 139064912 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] furan-3-carboxylate |
| SMILES | O=C(O[C@@H]1CCCC[C@H]1c1ccccc1)c1ccoc1 |
| InChI | InChI=1S/C17H18O3/c18-17(14-10-11-19-12-14)20-16-9-5-4-8-15(16)13-6-2-1-3-7-13/h1-3,6-7,10-12,15-16H,4-5,8-9H2/t15-,16+/m0/s1 |
| InChIKey | NMCAFLNCJZDUMQ-JKSUJKDBSA-N |
| XLogP | 4.16 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |