C26H29NO5 — CID 10717742
[(1S,2R,7R,8R,9R)-2-[(1R,2S)-2-phenylcyclohexyl]oxy-3,5-dioxa-4-azatricyclo[5.2.1.04,8]decan-9-yl] benzoate (PubChem CID 10717742) has the molecular formula C26H29NO5 and a molecular weight of 435.52 g/mol. Its IUPAC name is [(1S,2R,7R,8R,9R)-2-[(1R,2S)-2-phenylcyclohexyl]oxy-3,5-dioxa-4-azatricyclo[5.2.1.04,8]decan-9-yl] benzoate.
| Compound Name | [(1S,2R,7R,8R,9R)-2-[(1R,2S)-2-phenylcyclohexyl]oxy-3,5-dioxa-4-azatricyclo[5.2.1.04,8]decan-9-yl] benzoate |
|---|---|
| PubChem CID | 10717742 |
| Molecular Formula | C26H29NO5 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | [(1S,2R,7R,8R,9R)-2-[(1R,2S)-2-phenylcyclohexyl]oxy-3,5-dioxa-4-azatricyclo[5.2.1.04,8]decan-9-yl] benzoate |
| SMILES | O=C(O[C@@H]1[C@@H]2C[C@H]3CON(O[C@H]2O[C@@H]2CCCC[C@H]2c2ccccc2)[C@H]31)c1ccccc1 |
| InChI | InChI=1S/C26H29NO5/c28-25(18-11-5-2-6-12-18)31-24-21-15-19-16-29-27(23(19)24)32-26(21)30-22-14-8-7-13-20(22)17-9-3-1-4-10-17/h1-6,9-12,19-24,26H,7-8,13-16H2/t19-,20-,21-,22+,23+,24+,26+/m0/s1 |
| InChIKey | QYKPNWCBYLASNB-JFNYPIQHSA-N |
| XLogP | 4.48 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |