C31H41NO7Si — CID 11071850
propan-2-yl (3R,4R,7S,8S,9S,11R)-8-[dimethyl(phenyl)silyl]-5-hydroxy-9-[(1R,2S)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate (PubChem CID 11071850) has the molecular formula C31H41NO7Si and a molecular weight of 567.76 g/mol. Its IUPAC name is propan-2-yl (3R,4R,7S,8S,9S,11R)-8-[dimethyl(phenyl)silyl]-5-hydroxy-9-[(1R,2S)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate.
| Compound Name | propan-2-yl (3R,4R,7S,8S,9S,11R)-8-[dimethyl(phenyl)silyl]-5-hydroxy-9-[(1R,2S)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
|---|---|
| PubChem CID | 11071850 |
| Molecular Formula | C31H41NO7Si |
| Molecular Weight | 567.76 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | propan-2-yl (3R,4R,7S,8S,9S,11R)-8-[dimethyl(phenyl)silyl]-5-hydroxy-9-[(1R,2S)-2-phenylcyclohexyl]oxy-2,6,10-trioxa-1-azatricyclo[5.3.1.04,11]undecane-3-carboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1ON2O[C@H](O[C@@H]3CCCC[C@H]3c3ccccc3)[C@@H]([Si](C)(C)c3ccccc3)[C@H]3OC(O)[C@@H]1[C@H]32 |
| InChI | InChI=1S/C31H41NO7Si/c1-19(2)35-30(34)26-24-25-27(37-29(24)33)28(40(3,4)21-15-9-6-10-16-21)31(39-32(25)38-26)36-23-18-12-11-17-22(23)20-13-7-5-8-14-20/h5-10,13-16,19,22-29,31,33H,11-12,17-18H2,1-4H3/t22-,23+,24+,25+,26+,27-,28-,29?,31-/m0/s1 |
| InChIKey | HCBIDYLKITVBDV-MLALJDFISA-N |
| XLogP | 4.26 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.76 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|