C26H48O3Si4 — CID 11179951
trans-[(1R,2S)-2-phenylcyclohexyl] (1S,2S)-2-tris(trimethylsilyl)silyloxycyclobutane-1-carboxylate (PubChem CID 11179951) has the molecular formula C26H48O3Si4 and a molecular weight of 521.01 g/mol. Its IUPAC name is trans-[(1R,2S)-2-phenylcyclohexyl] (1S,2S)-2-tris(trimethylsilyl)silyloxycyclobutane-1-carboxylate.
| Compound Name | trans-[(1R,2S)-2-phenylcyclohexyl] (1S,2S)-2-tris(trimethylsilyl)silyloxycyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 11179951 |
| Molecular Formula | C26H48O3Si4 |
| Molecular Weight | 521.01 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | trans-[(1R,2S)-2-phenylcyclohexyl] (1S,2S)-2-tris(trimethylsilyl)silyloxycyclobutane-1-carboxylate |
| SMILES | C[Si](C)(C)[Si](O[C@H]1CC[C@@H]1C(=O)O[C@@H]1CCCC[C@H]1c1ccccc1)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C26H48O3Si4/c1-30(2,3)33(31(4,5)6,32(7,8)9)29-25-20-19-23(25)26(27)28-24-18-14-13-17-22(24)21-15-11-10-12-16-21/h10-12,15-16,22-25H,13-14,17-20H2,1-9H3/t22-,23-,24+,25-/m0/s1 |
| InChIKey | SUYZDTDFBIWSOB-JBXUNAHCSA-N |
| XLogP | 7.25 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.01 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|