C22H28O2Si — CID 102068633
(2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]acetate (PubChem CID 102068633) has the molecular formula C22H28O2Si and a molecular weight of 352.55 g/mol. Its IUPAC name is (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]acetate.
| Compound Name | (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]acetate |
|---|---|
| PubChem CID | 102068633 |
| Molecular Formula | C22H28O2Si |
| Molecular Weight | 352.55 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]acetate |
| SMILES | C[Si](C)(CC(=O)OC1CCCCC1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28O2Si/c1-25(2,19-13-7-4-8-14-19)17-22(23)24-21-16-10-9-15-20(21)18-11-5-3-6-12-18/h3-8,11-14,20-21H,9-10,15-17H2,1-2H3 |
| InChIKey | GVJAXVUBTBVPHR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.55 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|