C26H26O2S — CID 102062862
[(1R,2S)-2-(4-phenylphenyl)cyclohexyl] 2-phenylsulfanylacetate (PubChem CID 102062862) has the molecular formula C26H26O2S and a molecular weight of 402.56 g/mol. Its IUPAC name is [(1R,2S)-2-(4-phenylphenyl)cyclohexyl] 2-phenylsulfanylacetate.
| Compound Name | [(1R,2S)-2-(4-phenylphenyl)cyclohexyl] 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 102062862 |
| Molecular Formula | C26H26O2S |
| Molecular Weight | 402.56 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | [(1R,2S)-2-(4-phenylphenyl)cyclohexyl] 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)O[C@@H]1CCCC[C@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C26H26O2S/c27-26(19-29-23-11-5-2-6-12-23)28-25-14-8-7-13-24(25)22-17-15-21(16-18-22)20-9-3-1-4-10-20/h1-6,9-12,15-18,24-25H,7-8,13-14,19H2/t24-,25+/m0/s1 |
| InChIKey | IDJCSNFQQSTCPJ-LOSJGSFVSA-N |
| XLogP | 6.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.56 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |