C26H32N2O4 — CID 134883244
[(1R,2S)-2-phenylcyclohexyl] N-[[(1R,2S)-2-phenylcyclohexyl]oxycarbonylamino]carbamate (PubChem CID 134883244) has the molecular formula C26H32N2O4 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] N-[[(1R,2S)-2-phenylcyclohexyl]oxycarbonylamino]carbamate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] N-[[(1R,2S)-2-phenylcyclohexyl]oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 134883244 |
| Molecular Formula | C26H32N2O4 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.24 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] N-[[(1R,2S)-2-phenylcyclohexyl]oxycarbonylamino]carbamate |
| SMILES | O=C(NNC(=O)O[C@@H]1CCCC[C@H]1c1ccccc1)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C26H32N2O4/c29-25(31-23-17-9-7-15-21(23)19-11-3-1-4-12-19)27-28-26(30)32-24-18-10-8-16-22(24)20-13-5-2-6-14-20/h1-6,11-14,21-24H,7-10,15-18H2,(H,27,29)(H,28,30)/t21-,22-,23+,24+/m0/s1 |
| InChIKey | VWRWRQNFEYZXNL-CJRSTVEYSA-N |
| XLogP | 5.81 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|