C21H27Br2NO2 — CID 10696245
[(1R,2S)-2-phenylcyclohexyl] N-[2-[(1R,5S)-6,6-dibromo-3-bicyclo[3.1.0]hexanyl]ethyl]carbamate (PubChem CID 10696245) has the molecular formula C21H27Br2NO2 and a molecular weight of 485.26 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] N-[2-[(1R,5S)-6,6-dibromo-3-bicyclo[3.1.0]hexanyl]ethyl]carbamate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] N-[2-[(1R,5S)-6,6-dibromo-3-bicyclo[3.1.0]hexanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 10696245 |
| Molecular Formula | C21H27Br2NO2 |
| Molecular Weight | 485.26 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] N-[2-[(1R,5S)-6,6-dibromo-3-bicyclo[3.1.0]hexanyl]ethyl]carbamate |
| SMILES | O=C(NCCC1C[C@@H]2[C@H](C1)C2(Br)Br)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H27Br2NO2/c22-21(23)17-12-14(13-18(17)21)10-11-24-20(25)26-19-9-5-4-8-16(19)15-6-2-1-3-7-15/h1-3,6-7,14,16-19H,4-5,8-13H2,(H,24,25)/t14?,16-,17-,18+,19+/m0/s1 |
| InChIKey | ATYZBDSKLIWMSX-DNYQBBQESA-N |
| XLogP | 5.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.26 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|