C13H15ClO2 — CID 15691294
[(1R,2S)-2-phenylcyclohexyl] carbonochloridate (PubChem CID 15691294) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl] carbonochloridate.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl] carbonochloridate |
|---|---|
| PubChem CID | 15691294 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl] carbonochloridate |
| SMILES | O=C(Cl)O[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H15ClO2/c14-13(15)16-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m0/s1 |
| InChIKey | YHSJXFDZMQPYCU-NWDGAFQWSA-N |
| XLogP | 4.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|