C12H16O2P- — CID 102484366
[(1R,2S)-2-phenylcyclohexyl]oxyphosphinite (PubChem CID 102484366) has the molecular formula C12H16O2P- and a molecular weight of 223.23 g/mol. Its IUPAC name is [(1R,2S)-2-phenylcyclohexyl]oxyphosphinite.
| Compound Name | [(1R,2S)-2-phenylcyclohexyl]oxyphosphinite |
|---|---|
| PubChem CID | 102484366 |
| Molecular Formula | C12H16O2P- |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.09 |
| IUPAC Name | [(1R,2S)-2-phenylcyclohexyl]oxyphosphinite |
| SMILES | [O-]PO[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16O2P/c13-15-14-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11-12,15H,4-5,8-9H2/q-1/t11-,12+/m0/s1 |
| InChIKey | DJRLABNWRVVERY-NWDGAFQWSA-N |
| XLogP | 2.60 |
| TPSA | 32.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|