C12H18ClN — CID 21128019
trans-(1S,2R)-2-phenylcyclohexan-1-amine;hydrochloride (PubChem CID 21128019) has the molecular formula C12H18ClN and a molecular weight of 211.74 g/mol. Its IUPAC name is trans-(1S,2R)-2-phenylcyclohexan-1-amine;hydrochloride.
| Compound Name | trans-(1S,2R)-2-phenylcyclohexan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 21128019 |
| Molecular Formula | C12H18ClN |
| Molecular Weight | 211.74 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | trans-(1S,2R)-2-phenylcyclohexan-1-amine;hydrochloride |
| SMILES | Cl.N[C@H]1CCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C12H17N.ClH/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10;/h1-3,6-7,11-12H,4-5,8-9,13H2;1H/t11-,12+;/m1./s1 |
| InChIKey | FPWNXZWCBDBELJ-LYCTWNKOSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.74 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |