C11H15NO — CID 140767373
(3S,4R)-3-phenyloxan-4-amine (PubChem CID 140767373) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is (3S,4R)-3-phenyloxan-4-amine.
| Compound Name | (3S,4R)-3-phenyloxan-4-amine |
|---|---|
| PubChem CID | 140767373 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | (3S,4R)-3-phenyloxan-4-amine |
| SMILES | N[C@@H]1CCOC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C11H15NO/c12-11-6-7-13-8-10(11)9-4-2-1-3-5-9/h1-5,10-11H,6-8,12H2/t10-,11+/m0/s1 |
| InChIKey | ZROHCEQBZSVASC-WDEREUQCSA-N |
| XLogP | 1.52 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |