C13H17Cl — CID 130762341
[(1R,2R)-2-(chloromethyl)cyclohexyl]benzene (PubChem CID 130762341) has the molecular formula C13H17Cl and a molecular weight of 208.73 g/mol. Its IUPAC name is [(1R,2R)-2-(chloromethyl)cyclohexyl]benzene.
| Compound Name | [(1R,2R)-2-(chloromethyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 130762341 |
| Molecular Formula | C13H17Cl |
| Molecular Weight | 208.73 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | [(1R,2R)-2-(chloromethyl)cyclohexyl]benzene |
| SMILES | ClC[C@@H]1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C13H17Cl/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-3,6-7,12-13H,4-5,8-10H2/t12-,13-/m0/s1 |
| InChIKey | ROGMLQINHPXVFT-STQMWFEESA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.73 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|