C16H20O — CID 102426491
[(1R,2S)-2-buta-1,3-dien-2-yloxycyclohexyl]benzene (PubChem CID 102426491) has the molecular formula C16H20O and a molecular weight of 228.34 g/mol. Its IUPAC name is [(1R,2S)-2-buta-1,3-dien-2-yloxycyclohexyl]benzene.
| Compound Name | [(1R,2S)-2-buta-1,3-dien-2-yloxycyclohexyl]benzene |
|---|---|
| PubChem CID | 102426491 |
| Molecular Formula | C16H20O |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(1R,2S)-2-buta-1,3-dien-2-yloxycyclohexyl]benzene |
| SMILES | C=CC(=C)O[C@H]1CCCC[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H20O/c1-3-13(2)17-16-12-8-7-11-15(16)14-9-5-4-6-10-14/h3-6,9-10,15-16H,1-2,7-8,11-12H2/t15-,16+/m1/s1 |
| InChIKey | OKKJQUAXVWXKOO-CVEARBPZSA-N |
| XLogP | 4.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|