C22H24O3 — CID 139636652
(2-phenylcyclohexyl) (2R)-2-hydroxy-4-phenylbut-3-enoate (PubChem CID 139636652) has the molecular formula C22H24O3 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2-phenylcyclohexyl) (2R)-2-hydroxy-4-phenylbut-3-enoate.
| Compound Name | (2-phenylcyclohexyl) (2R)-2-hydroxy-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 139636652 |
| Molecular Formula | C22H24O3 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | (2-phenylcyclohexyl) (2R)-2-hydroxy-4-phenylbut-3-enoate |
| SMILES | O=C(OC1CCCCC1c1ccccc1)[C@H](O)C=Cc1ccccc1 |
| InChI | InChI=1S/C22H24O3/c23-20(16-15-17-9-3-1-4-10-17)22(24)25-21-14-8-7-13-19(21)18-11-5-2-6-12-18/h1-6,9-12,15-16,19-21,23H,7-8,13-14H2/t19?,20-,21?/m1/s1 |
| InChIKey | IAPRTACWOFEUQQ-NYLDSWQDSA-N |
| XLogP | 4.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |