C23H30O2Si — CID 102068637
(2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]propanoate (PubChem CID 102068637) has the molecular formula C23H30O2Si and a molecular weight of 366.58 g/mol. Its IUPAC name is (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]propanoate.
| Compound Name | (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]propanoate |
|---|---|
| PubChem CID | 102068637 |
| Molecular Formula | C23H30O2Si |
| Molecular Weight | 366.58 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | (2-phenylcyclohexyl) 2-[dimethyl(phenyl)silyl]propanoate |
| SMILES | CC(C(=O)OC1CCCCC1c1ccccc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C23H30O2Si/c1-18(26(2,3)20-14-8-5-9-15-20)23(24)25-22-17-11-10-16-21(22)19-12-6-4-7-13-19/h4-9,12-15,18,21-22H,10-11,16-17H2,1-3H3 |
| InChIKey | XOJDVCLECOCFOX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|