About [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate
[(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate (PubChem CID 2755291) has the molecular formula C21H20O2
and a molecular weight of 304.39 g/mol. Its IUPAC name is [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate.
Molecular Properties
| Compound Name | [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate |
| PubChem CID | 2755291 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate |
| SMILES | O=C(C#Cc1ccccc1)OC1CCCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C21H20O2/c22-21(16-15-17-9-3-1-4-10-17)23-20-14-8-7-13-19(20)18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-14H2/t19-,20?/m0/s1 |
| InChIKey | KDILHQHTMZNVSW-XJDOXCRVSA-N |
| XLogP | 4.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate?
The IUPAC name of [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate (CID 2755291) is [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate.
What is the SMILES notation for [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate?
The canonical SMILES for [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate is O=C(C#Cc1ccccc1)OC1CCCC[C@H]1c1ccccc1.
What is the InChIKey of [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate?
The InChIKey is KDILHQHTMZNVSW-XJDOXCRVSA-N. The full InChI is InChI=1S/C21H20O2/c22-21(16-15-17-9-3-1-4-10-17)23-20-14-8-7-13-19(20)18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-14H2/t19-,20?/m0/s1.
What are the key properties of [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate?
[(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate has a molecular weight of 304.39 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-2-phenylcyclohexyl] 3-phenylprop-2-ynoate is sourced from PubChem (CID 2755291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).