C27H34O4 — CID 101340527
1-O-tert-butyl 5-O-[(1R,2S)-2-phenylcyclohexyl] (3R)-3-phenylpentanedioate (PubChem CID 101340527) has the molecular formula C27H34O4 and a molecular weight of 422.57 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[(1R,2S)-2-phenylcyclohexyl] (3R)-3-phenylpentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-[(1R,2S)-2-phenylcyclohexyl] (3R)-3-phenylpentanedioate |
|---|---|
| PubChem CID | 101340527 |
| Molecular Formula | C27H34O4 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 1-O-tert-butyl 5-O-[(1R,2S)-2-phenylcyclohexyl] (3R)-3-phenylpentanedioate |
| SMILES | CC(C)(C)OC(=O)CC(CC(=O)O[C@@H]1CCCC[C@H]1c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H34O4/c1-27(2,3)31-26(29)19-22(20-12-6-4-7-13-20)18-25(28)30-24-17-11-10-16-23(24)21-14-8-5-9-15-21/h4-9,12-15,22-24H,10-11,16-19H2,1-3H3/t22?,23-,24+/m0/s1 |
| InChIKey | RBUGWOMERXBWPS-YDUIRMPASA-N |
| XLogP | 6.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |