C26H34O4 — CID 11825750
3-O-tert-butyl 2-O-[(1R,2S)-2-phenylcyclohexyl] (1R,2S,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate (PubChem CID 11825750) has the molecular formula C26H34O4 and a molecular weight of 410.55 g/mol. Its IUPAC name is 3-O-tert-butyl 2-O-[(1R,2S)-2-phenylcyclohexyl] (1R,2S,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate.
| Compound Name | 3-O-tert-butyl 2-O-[(1R,2S)-2-phenylcyclohexyl] (1R,2S,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
|---|---|
| PubChem CID | 11825750 |
| Molecular Formula | C26H34O4 |
| Molecular Weight | 410.55 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | 3-O-tert-butyl 2-O-[(1R,2S)-2-phenylcyclohexyl] (1R,2S,3R,4S)-bicyclo[2.2.2]oct-5-ene-2,3-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1[C@@H](C(=O)O[C@@H]2CCCC[C@H]2c2ccccc2)[C@H]2C=C[C@@H]1CC2 |
| InChI | InChI=1S/C26H34O4/c1-26(2,3)30-25(28)23-19-15-13-18(14-16-19)22(23)24(27)29-21-12-8-7-11-20(21)17-9-5-4-6-10-17/h4-6,9-10,13,15,18-23H,7-8,11-12,14,16H2,1-3H3/t18-,19+,20-,21+,22-,23+/m0/s1 |
| InChIKey | VJKPYGAPCFWLII-HXJAPYIESA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|