C15H20O3 — CID 11054002
tert-butyl (2S,3S)-3-phenyloxolane-2-carboxylate (PubChem CID 11054002) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-phenyloxolane-2-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-phenyloxolane-2-carboxylate |
|---|---|
| PubChem CID | 11054002 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | tert-butyl (2S,3S)-3-phenyloxolane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1OCC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H20O3/c1-15(2,3)18-14(16)13-12(9-10-17-13)11-7-5-4-6-8-11/h4-8,12-13H,9-10H2,1-3H3/t12-,13-/m0/s1 |
| InChIKey | ZLYLTSAQZSVGPA-STQMWFEESA-N |
| XLogP | 2.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |