C21H23NO2 — CID 138979616
tert-butyl (2S)-3,5-diphenyl-3,4-dihydro-2H-pyrrole-2-carboxylate (PubChem CID 138979616) has the molecular formula C21H23NO2 and a molecular weight of 321.42 g/mol. Its IUPAC name is tert-butyl (2S)-3,5-diphenyl-3,4-dihydro-2H-pyrrole-2-carboxylate.
| Compound Name | tert-butyl (2S)-3,5-diphenyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 138979616 |
| Molecular Formula | C21H23NO2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | tert-butyl (2S)-3,5-diphenyl-3,4-dihydro-2H-pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@H]1N=C(c2ccccc2)CC1c1ccccc1 |
| InChI | InChI=1S/C21H23NO2/c1-21(2,3)24-20(23)19-17(15-10-6-4-7-11-15)14-18(22-19)16-12-8-5-9-13-16/h4-13,17,19H,14H2,1-3H3/t17?,19-/m0/s1 |
| InChIKey | XGAXZRDINCUWGU-NNBQYGFHSA-N |
| XLogP | 4.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |