C19H22O4 — CID 101223448
tert-butyl (6S)-2-acetyl-4-oxo-6-phenylcyclohex-2-ene-1-carboxylate (PubChem CID 101223448) has the molecular formula C19H22O4 and a molecular weight of 314.38 g/mol. Its IUPAC name is tert-butyl (6S)-2-acetyl-4-oxo-6-phenylcyclohex-2-ene-1-carboxylate.
| Compound Name | tert-butyl (6S)-2-acetyl-4-oxo-6-phenylcyclohex-2-ene-1-carboxylate |
|---|---|
| PubChem CID | 101223448 |
| Molecular Formula | C19H22O4 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl (6S)-2-acetyl-4-oxo-6-phenylcyclohex-2-ene-1-carboxylate |
| SMILES | CC(=O)C1=CC(=O)C[C@H](c2ccccc2)C1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H22O4/c1-12(20)15-10-14(21)11-16(13-8-6-5-7-9-13)17(15)18(22)23-19(2,3)4/h5-10,16-17H,11H2,1-4H3/t16-,17?/m1/s1 |
| InChIKey | FPBXKTMIGHBYOI-TZHYSIJRSA-N |
| XLogP | 3.22 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |