C28H34O5 — CID 102122342
trans-ditert-butyl (2S,6S)-4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate (PubChem CID 102122342) has the molecular formula C28H34O5 and a molecular weight of 450.58 g/mol. Its IUPAC name is trans-ditert-butyl (2S,6S)-4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate.
| Compound Name | trans-ditert-butyl (2S,6S)-4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102122342 |
| Molecular Formula | C28H34O5 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | trans-ditert-butyl (2S,6S)-4-oxo-2,6-diphenylcyclohexane-1,1-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)C1(C(=O)OC(C)(C)C)[C@H](c2ccccc2)CC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C28H34O5/c1-26(2,3)32-24(30)28(25(31)33-27(4,5)6)22(19-13-9-7-10-14-19)17-21(29)18-23(28)20-15-11-8-12-16-20/h7-16,22-23H,17-18H2,1-6H3/t22-,23-/m0/s1 |
| InChIKey | DLPFLIQROMDOON-GOTSBHOMSA-N |
| XLogP | 5.59 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|