C15H24O4 — CID 101184936
tert-butyl 1-acetyl-2,6-dimethyl-4-oxocyclohexane-1-carboxylate (PubChem CID 101184936) has the molecular formula C15H24O4 and a molecular weight of 268.35 g/mol. Its IUPAC name is tert-butyl 1-acetyl-2,6-dimethyl-4-oxocyclohexane-1-carboxylate.
| Compound Name | tert-butyl 1-acetyl-2,6-dimethyl-4-oxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 101184936 |
| Molecular Formula | C15H24O4 |
| Molecular Weight | 268.35 g/mol |
| Exact Mass | 268.17 |
| IUPAC Name | tert-butyl 1-acetyl-2,6-dimethyl-4-oxocyclohexane-1-carboxylate |
| SMILES | CC(=O)C1(C(=O)OC(C)(C)C)C(C)CC(=O)CC1C |
| InChI | InChI=1S/C15H24O4/c1-9-7-12(17)8-10(2)15(9,11(3)16)13(18)19-14(4,5)6/h9-10H,7-8H2,1-6H3 |
| InChIKey | RVGINLFJSBALRN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|