About 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid
2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid (PubChem CID 159985791) has the molecular formula C11H16O8
and a molecular weight of 276.24 g/mol. Its IUPAC name is 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid |
| PubChem CID | 159985791 |
| Molecular Formula | C11H16O8 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid |
| SMILES | CC(C)(C)OC(=O)C1(CC(=O)O)OCOC(=O)C1O |
| InChI | InChI=1S/C11H16O8/c1-10(2,3)19-9(16)11(4-6(12)13)7(14)8(15)17-5-18-11/h7,14H,4-5H2,1-3H3,(H,12,13) |
| InChIKey | YCAUNWVBAPHCNU-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid?
The IUPAC name of 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid (CID 159985791) is 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid.
What is the SMILES notation for 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid?
The canonical SMILES for 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid is CC(C)(C)OC(=O)C1(CC(=O)O)OCOC(=O)C1O.
What is the InChIKey of 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid?
The InChIKey is YCAUNWVBAPHCNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O8/c1-10(2,3)19-9(16)11(4-6(12)13)7(14)8(15)17-5-18-11/h7,14H,4-5H2,1-3H3,(H,12,13).
What are the key properties of 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid?
2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid has a molecular weight of 276.24 g/mol, XLogP of -0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-hydroxy-4-[(2-methylpropan-2-yl)oxycarbonyl]-6-oxo-1,3-dioxan-4-yl]acetic acid is sourced from PubChem (CID 159985791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).